C18H15Cl2N3O3S — CID 15523744
N-benzyl-3,3-dichloro-N-(2-cyanoethyl)-2-oxo-1H-indole-5-sulfonamide (PubChem CID 15523744) has the molecular formula C18H15Cl2N3O3S and a molecular weight of 424.31 g/mol. Its IUPAC name is N-benzyl-3,3-dichloro-N-(2-cyanoethyl)-2-oxo-1H-indole-5-sulfonamide.
| Compound Name | N-benzyl-3,3-dichloro-N-(2-cyanoethyl)-2-oxo-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 15523744 |
| Molecular Formula | C18H15Cl2N3O3S |
| Molecular Weight | 424.31 g/mol |
| Exact Mass | 423.02 |
| IUPAC Name | N-benzyl-3,3-dichloro-N-(2-cyanoethyl)-2-oxo-1H-indole-5-sulfonamide |
| SMILES | N#CCCN(Cc1ccccc1)S(=O)(=O)c1ccc2c(c1)C(Cl)(Cl)C(=O)N2 |
| InChI | InChI=1S/C18H15Cl2N3O3S/c19-18(20)15-11-14(7-8-16(15)22-17(18)24)27(25,26)23(10-4-9-21)12-13-5-2-1-3-6-13/h1-3,5-8,11H,4,10,12H2,(H,22,24) |
| InChIKey | LIFCNRHSSLSSSF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|