C20H24N2O2S — CID 23853525
N-benzyl-N-(2-cyanoethyl)-2,3,5,6-tetramethylbenzenesulfonamide (PubChem CID 23853525) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is N-benzyl-N-(2-cyanoethyl)-2,3,5,6-tetramethylbenzenesulfonamide.
| Compound Name | N-benzyl-N-(2-cyanoethyl)-2,3,5,6-tetramethylbenzenesulfonamide |
|---|---|
| PubChem CID | 23853525 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | N-benzyl-N-(2-cyanoethyl)-2,3,5,6-tetramethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N(CCC#N)Cc2ccccc2)c1C |
| InChI | InChI=1S/C20H24N2O2S/c1-15-13-16(2)18(4)20(17(15)3)25(23,24)22(12-8-11-21)14-19-9-6-5-7-10-19/h5-7,9-10,13H,8,12,14H2,1-4H3 |
| InChIKey | ODEXLMYRFLXTLW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |