C23H25NO2S — CID 22202594
N-benzyl-2,3,5,6-tetramethyl-N-phenylbenzenesulfonamide (PubChem CID 22202594) has the molecular formula C23H25NO2S and a molecular weight of 379.52 g/mol. Its IUPAC name is N-benzyl-2,3,5,6-tetramethyl-N-phenylbenzenesulfonamide.
| Compound Name | N-benzyl-2,3,5,6-tetramethyl-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 22202594 |
| Molecular Formula | C23H25NO2S |
| Molecular Weight | 379.52 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-benzyl-2,3,5,6-tetramethyl-N-phenylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N(Cc2ccccc2)c2ccccc2)c1C |
| InChI | InChI=1S/C23H25NO2S/c1-17-15-18(2)20(4)23(19(17)3)27(25,26)24(22-13-9-6-10-14-22)16-21-11-7-5-8-12-21/h5-15H,16H2,1-4H3 |
| InChIKey | FDOJMUGKRWVLFH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.52 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |