C39H32N2O4S2 — CID 3125889
2-N,7-N-dibenzyl-2-N,7-N-diphenyl-9H-fluorene-2,7-disulfonamide (PubChem CID 3125889) has the molecular formula C39H32N2O4S2 and a molecular weight of 656.83 g/mol. Its IUPAC name is 2-N,7-N-dibenzyl-2-N,7-N-diphenyl-9H-fluorene-2,7-disulfonamide.
| Compound Name | 2-N,7-N-dibenzyl-2-N,7-N-diphenyl-9H-fluorene-2,7-disulfonamide |
|---|---|
| PubChem CID | 3125889 |
| Molecular Formula | C39H32N2O4S2 |
| Molecular Weight | 656.83 g/mol |
| Exact Mass | 656.18 |
| IUPAC Name | 2-N,7-N-dibenzyl-2-N,7-N-diphenyl-9H-fluorene-2,7-disulfonamide |
| SMILES | O=S(=O)(c1ccc2c(c1)Cc1cc(S(=O)(=O)N(Cc3ccccc3)c3ccccc3)ccc1-2)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H32N2O4S2/c42-46(43,40(34-17-9-3-10-18-34)28-30-13-5-1-6-14-30)36-21-23-38-32(26-36)25-33-27-37(22-24-39(33)38)47(44,45)41(35-19-11-4-12-20-35)29-31-15-7-2-8-16-31/h1-24,26-27H,25,28-29H2 |
| InChIKey | PGNGZWBRZIVEJZ-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.83 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |