C13H19N3O2S — CID 106503686
3-amino-N-(2-cyanoethyl)-N,2,5,6-tetramethylbenzenesulfonamide (PubChem CID 106503686) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is 3-amino-N-(2-cyanoethyl)-N,2,5,6-tetramethylbenzenesulfonamide.
| Compound Name | 3-amino-N-(2-cyanoethyl)-N,2,5,6-tetramethylbenzenesulfonamide |
|---|---|
| PubChem CID | 106503686 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 3-amino-N-(2-cyanoethyl)-N,2,5,6-tetramethylbenzenesulfonamide |
| SMILES | Cc1cc(N)c(C)c(S(=O)(=O)N(C)CCC#N)c1C |
| InChI | InChI=1S/C13H19N3O2S/c1-9-8-12(15)11(3)13(10(9)2)19(17,18)16(4)7-5-6-14/h8H,5,7,15H2,1-4H3 |
| InChIKey | GYHFCSSYFHHXLQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|