C10H11BrClN3O2S — CID 62957583
3-amino-2-bromo-5-chloro-N-(2-cyanoethyl)-N-methylbenzenesulfonamide (PubChem CID 62957583) has the molecular formula C10H11BrClN3O2S and a molecular weight of 352.64 g/mol. Its IUPAC name is 3-amino-2-bromo-5-chloro-N-(2-cyanoethyl)-N-methylbenzenesulfonamide.
| Compound Name | 3-amino-2-bromo-5-chloro-N-(2-cyanoethyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 62957583 |
| Molecular Formula | C10H11BrClN3O2S |
| Molecular Weight | 352.64 g/mol |
| Exact Mass | 350.94 |
| IUPAC Name | 3-amino-2-bromo-5-chloro-N-(2-cyanoethyl)-N-methylbenzenesulfonamide |
| SMILES | CN(CCC#N)S(=O)(=O)c1cc(Cl)cc(N)c1Br |
| InChI | InChI=1S/C10H11BrClN3O2S/c1-15(4-2-3-13)18(16,17)9-6-7(12)5-8(14)10(9)11/h5-6H,2,4,14H2,1H3 |
| InChIKey | YODXSSIHGXTKIA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.64 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|