C11H15BrClN3O3S — CID 62955656
2-[(3-amino-2-bromo-5-chlorophenyl)sulfonyl-methylamino]-N,N-dimethylacetamide (PubChem CID 62955656) has the molecular formula C11H15BrClN3O3S and a molecular weight of 384.68 g/mol. Its IUPAC name is 2-[(3-amino-2-bromo-5-chlorophenyl)sulfonyl-methylamino]-N,N-dimethylacetamide.
| Compound Name | 2-[(3-amino-2-bromo-5-chlorophenyl)sulfonyl-methylamino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 62955656 |
| Molecular Formula | C11H15BrClN3O3S |
| Molecular Weight | 384.68 g/mol |
| Exact Mass | 382.97 |
| IUPAC Name | 2-[(3-amino-2-bromo-5-chlorophenyl)sulfonyl-methylamino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN(C)S(=O)(=O)c1cc(Cl)cc(N)c1Br |
| InChI | InChI=1S/C11H15BrClN3O3S/c1-15(2)10(17)6-16(3)20(18,19)9-5-7(13)4-8(14)11(9)12/h4-5H,6,14H2,1-3H3 |
| InChIKey | UIOQSYXOXZXXHH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.68 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|