C22H30O6 — CID 155238016
2-O-benzyl 1-O-[2-[2-(3,3-dimethylcyclohexyl)propanoyloxy]ethyl] oxalate (PubChem CID 155238016) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is 2-O-benzyl 1-O-[2-[2-(3,3-dimethylcyclohexyl)propanoyloxy]ethyl] oxalate.
| Compound Name | 2-O-benzyl 1-O-[2-[2-(3,3-dimethylcyclohexyl)propanoyloxy]ethyl] oxalate |
|---|---|
| PubChem CID | 155238016 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 2-O-benzyl 1-O-[2-[2-(3,3-dimethylcyclohexyl)propanoyloxy]ethyl] oxalate |
| SMILES | CC(C(=O)OCCOC(=O)C(=O)OCc1ccccc1)C1CCCC(C)(C)C1 |
| InChI | InChI=1S/C22H30O6/c1-16(18-10-7-11-22(2,3)14-18)19(23)26-12-13-27-20(24)21(25)28-15-17-8-5-4-6-9-17/h4-6,8-9,16,18H,7,10-15H2,1-3H3 |
| InChIKey | WZXKBZVZPDCBAE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|