C23H23N3O3 — CID 155239877
(2S,8S)-2-(2,3-dihydro-1-benzofuran-6-yl)-7-hydroxy-6-methyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-4-one (PubChem CID 155239877) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is (2S,8S)-2-(2,3-dihydro-1-benzofuran-6-yl)-7-hydroxy-6-methyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-4-one.
| Compound Name | (2S,8S)-2-(2,3-dihydro-1-benzofuran-6-yl)-7-hydroxy-6-methyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-4-one |
|---|---|
| PubChem CID | 155239877 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | (2S,8S)-2-(2,3-dihydro-1-benzofuran-6-yl)-7-hydroxy-6-methyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-4-one |
| SMILES | CN1CC(=O)N2[C@@H](c3ccc4c(c3)OCC4)c3[nH]c4ccccc4c3C[C@H]2C1O |
| InChI | InChI=1S/C23H23N3O3/c1-25-12-20(27)26-18(23(25)28)11-16-15-4-2-3-5-17(15)24-21(16)22(26)14-7-6-13-8-9-29-19(13)10-14/h2-7,10,18,22-24,28H,8-9,11-12H2,1H3/t18-,22-,23?/m0/s1 |
| InChIKey | PMTJMYMHPXRCRO-OFSKKJKASA-N |
| XLogP | 2.21 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|