C26H25N3O3 — CID 70165993
(2R,8R)-2-(2,3-dihydro-1-benzofuran-5-yl)-6-(1-methylcyclopropyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 70165993) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is (2R,8R)-2-(2,3-dihydro-1-benzofuran-5-yl)-6-(1-methylcyclopropyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (2R,8R)-2-(2,3-dihydro-1-benzofuran-5-yl)-6-(1-methylcyclopropyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 70165993 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | (2R,8R)-2-(2,3-dihydro-1-benzofuran-5-yl)-6-(1-methylcyclopropyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | CC1(N2CC(=O)N3[C@H](c4ccc5c(c4)CCO5)c4[nH]c5ccccc5c4C[C@@H]3C2=O)CC1 |
| InChI | InChI=1S/C26H25N3O3/c1-26(9-10-26)28-14-22(30)29-20(25(28)31)13-18-17-4-2-3-5-19(17)27-23(18)24(29)16-6-7-21-15(12-16)8-11-32-21/h2-7,12,20,24,27H,8-11,13-14H2,1H3/t20-,24-/m1/s1 |
| InChIKey | GUYRSZZVYMZYFZ-HYBUGGRVSA-N |
| XLogP | 3.34 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|