C17H11ClF2N4O2 — CID 155243138
5-(2-chlorophenyl)-N-(2,4-difluoro-6-nitrophenyl)-6-methylpyrimidin-4-amine (PubChem CID 155243138) has the molecular formula C17H11ClF2N4O2 and a molecular weight of 376.75 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-N-(2,4-difluoro-6-nitrophenyl)-6-methylpyrimidin-4-amine.
| Compound Name | 5-(2-chlorophenyl)-N-(2,4-difluoro-6-nitrophenyl)-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 155243138 |
| Molecular Formula | C17H11ClF2N4O2 |
| Molecular Weight | 376.75 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 5-(2-chlorophenyl)-N-(2,4-difluoro-6-nitrophenyl)-6-methylpyrimidin-4-amine |
| SMILES | Cc1ncnc(Nc2c(F)cc(F)cc2[N+](=O)[O-])c1-c1ccccc1Cl |
| InChI | InChI=1S/C17H11ClF2N4O2/c1-9-15(11-4-2-3-5-12(11)18)17(22-8-21-9)23-16-13(20)6-10(19)7-14(16)24(25)26/h2-8H,1H3,(H,21,22,23) |
| InChIKey | QQWAYULYJSXJIB-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.75 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|