C19H28N4O2S — CID 155244189
4-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[3-(tert-butylamino)phenyl]butanamide (PubChem CID 155244189) has the molecular formula C19H28N4O2S and a molecular weight of 376.53 g/mol. Its IUPAC name is 4-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[3-(tert-butylamino)phenyl]butanamide.
| Compound Name | 4-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[3-(tert-butylamino)phenyl]butanamide |
|---|---|
| PubChem CID | 155244189 |
| Molecular Formula | C19H28N4O2S |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 4-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[3-(tert-butylamino)phenyl]butanamide |
| SMILES | CC(C)(C)Nc1cccc(NC(=O)CCC[C@H]2SC[C@H]3NC(=O)N[C@H]32)c1 |
| InChI | InChI=1S/C19H28N4O2S/c1-19(2,3)23-13-7-4-6-12(10-13)20-16(24)9-5-8-15-17-14(11-26-15)21-18(25)22-17/h4,6-7,10,14-15,17,23H,5,8-9,11H2,1-3H3,(H,20,24)(H2,21,22,25)/t14-,15-,17-/m1/s1 |
| InChIKey | CENOMISPMKDNBC-BFYDXBDKSA-N |
| XLogP | 3.17 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|