C22H44O3 — CID 155246077
6,6-dioctoxyhexanal (PubChem CID 155246077) has the molecular formula C22H44O3 and a molecular weight of 356.59 g/mol. Its IUPAC name is 6,6-dioctoxyhexanal.
| Compound Name | 6,6-dioctoxyhexanal |
|---|---|
| PubChem CID | 155246077 |
| Molecular Formula | C22H44O3 |
| Molecular Weight | 356.59 g/mol |
| Exact Mass | 356.33 |
| IUPAC Name | 6,6-dioctoxyhexanal |
| SMILES | CCCCCCCCOC(CCCCC=O)OCCCCCCCC |
| InChI | InChI=1S/C22H44O3/c1-3-5-7-9-11-16-20-24-22(18-14-13-15-19-23)25-21-17-12-10-8-6-4-2/h19,22H,3-18,20-21H2,1-2H3 |
| InChIKey | WGFMBWLUMVCSOV-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.59 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|