C25H30F3N3O2S — CID 155248589
tert-butyl N-[2-[[1-[2-[4-(trifluoromethyl)phenyl]ethanethioyl]piperidin-4-yl]amino]phenyl]carbamate (PubChem CID 155248589) has the molecular formula C25H30F3N3O2S and a molecular weight of 493.60 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-[2-[4-(trifluoromethyl)phenyl]ethanethioyl]piperidin-4-yl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-[2-[4-(trifluoromethyl)phenyl]ethanethioyl]piperidin-4-yl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 155248589 |
| Molecular Formula | C25H30F3N3O2S |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | tert-butyl N-[2-[[1-[2-[4-(trifluoromethyl)phenyl]ethanethioyl]piperidin-4-yl]amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1NC1CCN(C(=S)Cc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C25H30F3N3O2S/c1-24(2,3)33-23(32)30-21-7-5-4-6-20(21)29-19-12-14-31(15-13-19)22(34)16-17-8-10-18(11-9-17)25(26,27)28/h4-11,19,29H,12-16H2,1-3H3,(H,30,32) |
| InChIKey | JCSOCGBZZFZJJT-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|