C21H27F3N2 — CID 155249750
4-methyl-3-[2-methyl-2-[4-(trifluoromethyl)anilino]propyl]-N-propan-2-ylaniline (PubChem CID 155249750) has the molecular formula C21H27F3N2 and a molecular weight of 364.46 g/mol. Its IUPAC name is 4-methyl-3-[2-methyl-2-[4-(trifluoromethyl)anilino]propyl]-N-propan-2-ylaniline.
| Compound Name | 4-methyl-3-[2-methyl-2-[4-(trifluoromethyl)anilino]propyl]-N-propan-2-ylaniline |
|---|---|
| PubChem CID | 155249750 |
| Molecular Formula | C21H27F3N2 |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | 4-methyl-3-[2-methyl-2-[4-(trifluoromethyl)anilino]propyl]-N-propan-2-ylaniline |
| SMILES | Cc1ccc(NC(C)C)cc1CC(C)(C)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H27F3N2/c1-14(2)25-19-9-6-15(3)16(12-19)13-20(4,5)26-18-10-7-17(8-11-18)21(22,23)24/h6-12,14,25-26H,13H2,1-5H3 |
| InChIKey | GWHKJBJVBRHTMJ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |