C16H24F3N — CID 59205123
4-(trifluoromethyl)-N-(2,5,5-trimethylhexan-3-yl)aniline (PubChem CID 59205123) has the molecular formula C16H24F3N and a molecular weight of 287.37 g/mol. Its IUPAC name is 4-(trifluoromethyl)-N-(2,5,5-trimethylhexan-3-yl)aniline.
| Compound Name | 4-(trifluoromethyl)-N-(2,5,5-trimethylhexan-3-yl)aniline |
|---|---|
| PubChem CID | 59205123 |
| Molecular Formula | C16H24F3N |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 4-(trifluoromethyl)-N-(2,5,5-trimethylhexan-3-yl)aniline |
| SMILES | CC(C)C(CC(C)(C)C)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H24F3N/c1-11(2)14(10-15(3,4)5)20-13-8-6-12(7-9-13)16(17,18)19/h6-9,11,14,20H,10H2,1-5H3 |
| InChIKey | YRADLKFIVPJQNT-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |