C24H25F3N4O — CID 58834495
N-[(2R)-3-methyl-2-[4-(trifluoromethyl)anilino]butyl]-4-(pyridin-4-ylamino)benzamide (PubChem CID 58834495) has the molecular formula C24H25F3N4O and a molecular weight of 442.49 g/mol. Its IUPAC name is N-[(2R)-3-methyl-2-[4-(trifluoromethyl)anilino]butyl]-4-(pyridin-4-ylamino)benzamide.
| Compound Name | N-[(2R)-3-methyl-2-[4-(trifluoromethyl)anilino]butyl]-4-(pyridin-4-ylamino)benzamide |
|---|---|
| PubChem CID | 58834495 |
| Molecular Formula | C24H25F3N4O |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | N-[(2R)-3-methyl-2-[4-(trifluoromethyl)anilino]butyl]-4-(pyridin-4-ylamino)benzamide |
| SMILES | CC(C)[C@H](CNC(=O)c1ccc(Nc2ccncc2)cc1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H25F3N4O/c1-16(2)22(31-20-9-5-18(6-10-20)24(25,26)27)15-29-23(32)17-3-7-19(8-4-17)30-21-11-13-28-14-12-21/h3-14,16,22,31H,15H2,1-2H3,(H,28,30)(H,29,32)/t22-/m0/s1 |
| InChIKey | PBNMVEUDZJDURE-QFIPXVFZSA-N |
| XLogP | 5.71 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |