C17H26F3N3O — CID 58834443
(2S)-2-amino-3-methyl-N-[(2R)-3-methyl-2-[4-(trifluoromethyl)anilino]butyl]butanamide (PubChem CID 58834443) has the molecular formula C17H26F3N3O and a molecular weight of 345.41 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-N-[(2R)-3-methyl-2-[4-(trifluoromethyl)anilino]butyl]butanamide.
| Compound Name | (2S)-2-amino-3-methyl-N-[(2R)-3-methyl-2-[4-(trifluoromethyl)anilino]butyl]butanamide |
|---|---|
| PubChem CID | 58834443 |
| Molecular Formula | C17H26F3N3O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | (2S)-2-amino-3-methyl-N-[(2R)-3-methyl-2-[4-(trifluoromethyl)anilino]butyl]butanamide |
| SMILES | CC(C)[C@H](CNC(=O)[C@@H](N)C(C)C)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H26F3N3O/c1-10(2)14(9-22-16(24)15(21)11(3)4)23-13-7-5-12(6-8-13)17(18,19)20/h5-8,10-11,14-15,23H,9,21H2,1-4H3,(H,22,24)/t14-,15-/m0/s1 |
| InChIKey | FRCBCGZXBDWPFG-GJZGRUSLSA-N |
| XLogP | 3.24 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |