C26H22F9N3O4 — CID 160534604
1,1,1,4,4,4-hexafluorobutane-2,3-dione;2-(1H-indol-3-yl)-N-[(2R)-3-methyl-2-[4-(trifluoromethyl)anilino]butyl]-2-oxoacetamide (PubChem CID 160534604) has the molecular formula C26H22F9N3O4 and a molecular weight of 611.46 g/mol. Its IUPAC name is 1,1,1,4,4,4-hexafluorobutane-2,3-dione;2-(1H-indol-3-yl)-N-[(2R)-3-methyl-2-[4-(trifluoromethyl)anilino]butyl]-2-oxoacetamide.
| Compound Name | 1,1,1,4,4,4-hexafluorobutane-2,3-dione;2-(1H-indol-3-yl)-N-[(2R)-3-methyl-2-[4-(trifluoromethyl)anilino]butyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 160534604 |
| Molecular Formula | C26H22F9N3O4 |
| Molecular Weight | 611.46 g/mol |
| Exact Mass | 611.15 |
| IUPAC Name | 1,1,1,4,4,4-hexafluorobutane-2,3-dione;2-(1H-indol-3-yl)-N-[(2R)-3-methyl-2-[4-(trifluoromethyl)anilino]butyl]-2-oxoacetamide |
| SMILES | CC(C)[C@H](CNC(=O)C(=O)c1c[nH]c2ccccc12)Nc1ccc(C(F)(F)F)cc1.O=C(C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H22F3N3O2.C4F6O2/c1-13(2)19(28-15-9-7-14(8-10-15)22(23,24)25)12-27-21(30)20(29)17-11-26-18-6-4-3-5-16(17)18;5-3(6,7)1(11)2(12)4(8,9)10/h3-11,13,19,26,28H,12H2,1-2H3,(H,27,30);/t19-;/m0./s1 |
| InChIKey | QVZHYOWRFHROID-FYZYNONXSA-N |
| XLogP | 5.87 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.46 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|