C22H24F3N3O — CID 11628784
(2R)-N-[2-(1H-indol-3-yl)ethyl]-3-methyl-2-[4-(trifluoromethyl)anilino]butanamide (PubChem CID 11628784) has the molecular formula C22H24F3N3O and a molecular weight of 403.45 g/mol. Its IUPAC name is (2R)-N-[2-(1H-indol-3-yl)ethyl]-3-methyl-2-[4-(trifluoromethyl)anilino]butanamide.
| Compound Name | (2R)-N-[2-(1H-indol-3-yl)ethyl]-3-methyl-2-[4-(trifluoromethyl)anilino]butanamide |
|---|---|
| PubChem CID | 11628784 |
| Molecular Formula | C22H24F3N3O |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | (2R)-N-[2-(1H-indol-3-yl)ethyl]-3-methyl-2-[4-(trifluoromethyl)anilino]butanamide |
| SMILES | CC(C)[C@@H](Nc1ccc(C(F)(F)F)cc1)C(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H24F3N3O/c1-14(2)20(28-17-9-7-16(8-10-17)22(23,24)25)21(29)26-12-11-15-13-27-19-6-4-3-5-18(15)19/h3-10,13-14,20,27-28H,11-12H2,1-2H3,(H,26,29)/t20-/m1/s1 |
| InChIKey | WHOXEOAWMZFITG-HXUWFJFHSA-N |
| XLogP | 4.98 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |