C19H23F3N2OS — CID 58834472
N-[(3S)-4-methyl-3-[4-(trifluoromethyl)anilino]pentyl]-2-thiophen-2-ylacetamide (PubChem CID 58834472) has the molecular formula C19H23F3N2OS and a molecular weight of 384.47 g/mol. Its IUPAC name is N-[(3S)-4-methyl-3-[4-(trifluoromethyl)anilino]pentyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[(3S)-4-methyl-3-[4-(trifluoromethyl)anilino]pentyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 58834472 |
| Molecular Formula | C19H23F3N2OS |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-[(3S)-4-methyl-3-[4-(trifluoromethyl)anilino]pentyl]-2-thiophen-2-ylacetamide |
| SMILES | CC(C)[C@H](CCNC(=O)Cc1cccs1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H23F3N2OS/c1-13(2)17(9-10-23-18(25)12-16-4-3-11-26-16)24-15-7-5-14(6-8-15)19(20,21)22/h3-8,11,13,17,24H,9-10,12H2,1-2H3,(H,23,25)/t17-/m0/s1 |
| InChIKey | KARIVILGDIIZID-KRWDZBQOSA-N |
| XLogP | 4.95 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |