C18H18N4O2S — CID 155250175
5-(4-quinolin-6-ylcyclohexyl)sulfanyl-2H-triazole-4-carboxylic acid (PubChem CID 155250175) has the molecular formula C18H18N4O2S and a molecular weight of 354.44 g/mol. Its IUPAC name is 5-(4-quinolin-6-ylcyclohexyl)sulfanyl-2H-triazole-4-carboxylic acid.
| Compound Name | 5-(4-quinolin-6-ylcyclohexyl)sulfanyl-2H-triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 155250175 |
| Molecular Formula | C18H18N4O2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 5-(4-quinolin-6-ylcyclohexyl)sulfanyl-2H-triazole-4-carboxylic acid |
| SMILES | O=C(O)c1n[nH]nc1SC1CCC(c2ccc3ncccc3c2)CC1 |
| InChI | InChI=1S/C18H18N4O2S/c23-18(24)16-17(21-22-20-16)25-14-6-3-11(4-7-14)12-5-8-15-13(10-12)2-1-9-19-15/h1-2,5,8-11,14H,3-4,6-7H2,(H,23,24)(H,20,21,22) |
| InChIKey | IBNIATLNURENIS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |