C21H26N4O4 — CID 155255114
N-[(1S,2S)-2-hydroxycyclohexyl]-2-[4-(1H-indole-2-carbonyl)piperazin-1-yl]-2-oxoacetamide (PubChem CID 155255114) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is N-[(1S,2S)-2-hydroxycyclohexyl]-2-[4-(1H-indole-2-carbonyl)piperazin-1-yl]-2-oxoacetamide.
| Compound Name | N-[(1S,2S)-2-hydroxycyclohexyl]-2-[4-(1H-indole-2-carbonyl)piperazin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 155255114 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | N-[(1S,2S)-2-hydroxycyclohexyl]-2-[4-(1H-indole-2-carbonyl)piperazin-1-yl]-2-oxoacetamide |
| SMILES | O=C(N[C@H]1CCCC[C@@H]1O)C(=O)N1CCN(C(=O)c2cc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C21H26N4O4/c26-18-8-4-3-7-16(18)23-19(27)21(29)25-11-9-24(10-12-25)20(28)17-13-14-5-1-2-6-15(14)22-17/h1-2,5-6,13,16,18,22,26H,3-4,7-12H2,(H,23,27)/t16-,18-/m0/s1 |
| InChIKey | ILUMIHIKJNNIGT-WMZOPIPTSA-N |
| XLogP | 0.87 |
| TPSA | 105.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|