About 1-O-(1-methylsulfonylpropan-2-yl) 4-O-octan-2-yl 2-methylidenebutanedioate
1-O-(1-methylsulfonylpropan-2-yl) 4-O-octan-2-yl 2-methylidenebutanedioate (PubChem CID 155255756) has the molecular formula C17H30O6S
and a molecular weight of 362.49 g/mol. Its IUPAC name is 1-O-(1-methylsulfonylpropan-2-yl) 4-O-octan-2-yl 2-methylidenebutanedioate.
Molecular Properties
| Compound Name | 1-O-(1-methylsulfonylpropan-2-yl) 4-O-octan-2-yl 2-methylidenebutanedioate |
| PubChem CID | 155255756 |
| Molecular Formula | C17H30O6S |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 1-O-(1-methylsulfonylpropan-2-yl) 4-O-octan-2-yl 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OC(C)CCCCCC)C(=O)OC(C)CS(C)(=O)=O |
| InChI | InChI=1S/C17H30O6S/c1-6-7-8-9-10-14(3)22-16(18)11-13(2)17(19)23-15(4)12-24(5,20)21/h14-15H,2,6-12H2,1,3-5H3 |
| InChIKey | DJCIFQIQNFWGNC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-(1-methylsulfonylpropan-2-yl) 4-O-octan-2-yl 2-methylidenebutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(1-methylsulfonylpropan-2-yl) 4-O-octan-2-yl 2-methylidenebutanedioate?
The IUPAC name of 1-O-(1-methylsulfonylpropan-2-yl) 4-O-octan-2-yl 2-methylidenebutanedioate (CID 155255756) is 1-O-(1-methylsulfonylpropan-2-yl) 4-O-octan-2-yl 2-methylidenebutanedioate.
What is the SMILES notation for 1-O-(1-methylsulfonylpropan-2-yl) 4-O-octan-2-yl 2-methylidenebutanedioate?
The canonical SMILES for 1-O-(1-methylsulfonylpropan-2-yl) 4-O-octan-2-yl 2-methylidenebutanedioate is C=C(CC(=O)OC(C)CCCCCC)C(=O)OC(C)CS(C)(=O)=O.
What is the InChIKey of 1-O-(1-methylsulfonylpropan-2-yl) 4-O-octan-2-yl 2-methylidenebutanedioate?
The InChIKey is DJCIFQIQNFWGNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O6S/c1-6-7-8-9-10-14(3)22-16(18)11-13(2)17(19)23-15(4)12-24(5,20)21/h14-15H,2,6-12H2,1,3-5H3.
What are the key properties of 1-O-(1-methylsulfonylpropan-2-yl) 4-O-octan-2-yl 2-methylidenebutanedioate?
1-O-(1-methylsulfonylpropan-2-yl) 4-O-octan-2-yl 2-methylidenebutanedioate has a molecular weight of 362.49 g/mol, XLogP of 2.81, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(1-methylsulfonylpropan-2-yl) 4-O-octan-2-yl 2-methylidenebutanedioate is sourced from PubChem (CID 155255756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).