C16H19ClN4O3 — CID 155256233
[4-[(6-chloro-1H-benzimidazol-2-yl)methylcarbamoyl]cyclohexyl]carbamic acid (PubChem CID 155256233) has the molecular formula C16H19ClN4O3 and a molecular weight of 350.81 g/mol. Its IUPAC name is [4-[(6-chloro-1H-benzimidazol-2-yl)methylcarbamoyl]cyclohexyl]carbamic acid.
| Compound Name | [4-[(6-chloro-1H-benzimidazol-2-yl)methylcarbamoyl]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 155256233 |
| Molecular Formula | C16H19ClN4O3 |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | [4-[(6-chloro-1H-benzimidazol-2-yl)methylcarbamoyl]cyclohexyl]carbamic acid |
| SMILES | O=C(O)NC1CCC(C(=O)NCc2nc3ccc(Cl)cc3[nH]2)CC1 |
| InChI | InChI=1S/C16H19ClN4O3/c17-10-3-6-12-13(7-10)21-14(20-12)8-18-15(22)9-1-4-11(5-2-9)19-16(23)24/h3,6-7,9,11,19H,1-2,4-5,8H2,(H,18,22)(H,20,21)(H,23,24) |
| InChIKey | JYZGIJKTIZUCHW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |