C21H27N5O5 — CID 171339483
N-[4-(1H-benzimidazol-2-ylmethylcarbamoyl)cyclohexyl]-5-oxopyrrolidine-2-carboxamide;formic acid (PubChem CID 171339483) has the molecular formula C21H27N5O5 and a molecular weight of 429.48 g/mol. Its IUPAC name is N-[4-(1H-benzimidazol-2-ylmethylcarbamoyl)cyclohexyl]-5-oxopyrrolidine-2-carboxamide;formic acid.
| Compound Name | N-[4-(1H-benzimidazol-2-ylmethylcarbamoyl)cyclohexyl]-5-oxopyrrolidine-2-carboxamide;formic acid |
|---|---|
| PubChem CID | 171339483 |
| Molecular Formula | C21H27N5O5 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | N-[4-(1H-benzimidazol-2-ylmethylcarbamoyl)cyclohexyl]-5-oxopyrrolidine-2-carboxamide;formic acid |
| SMILES | O=C1CCC(C(=O)NC2CCC(C(=O)NCc3nc4ccccc4[nH]3)CC2)N1.O=CO |
| InChI | InChI=1S/C20H25N5O3.CH2O2/c26-18-10-9-16(25-18)20(28)22-13-7-5-12(6-8-13)19(27)21-11-17-23-14-3-1-2-4-15(14)24-17;2-1-3/h1-4,12-13,16H,5-11H2,(H,21,27)(H,22,28)(H,23,24)(H,25,26);1H,(H,2,3) |
| InChIKey | JWBGOSOEIAWYKE-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 153.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|