C20H21FN4O3S — CID 7546016
N-(1H-benzimidazol-2-ylmethyl)-1-(4-fluorophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 7546016) has the molecular formula C20H21FN4O3S and a molecular weight of 416.48 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-1-(4-fluorophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-1-(4-fluorophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 7546016 |
| Molecular Formula | C20H21FN4O3S |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-1-(4-fluorophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NCc1nc2ccccc2[nH]1)C1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H21FN4O3S/c21-15-5-7-16(8-6-15)29(27,28)25-11-9-14(10-12-25)20(26)22-13-19-23-17-3-1-2-4-18(17)24-19/h1-8,14H,9-13H2,(H,22,26)(H,23,24) |
| InChIKey | PCJXQLXJEBOANB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |