C20H22N4O3S — CID 71904706
N-(1H-benzimidazol-2-ylmethyl)-2-piperidin-1-ylsulfonylbenzamide (PubChem CID 71904706) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-2-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-2-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 71904706 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-2-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NCc1nc2ccccc2[nH]1)c1ccccc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C20H22N4O3S/c25-20(21-14-19-22-16-9-3-4-10-17(16)23-19)15-8-2-5-11-18(15)28(26,27)24-12-6-1-7-13-24/h2-5,8-11H,1,6-7,12-14H2,(H,21,25)(H,22,23) |
| InChIKey | DGIRQMUOHRUVMA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |