C27H39O3P — CID 155257563
(4-heptyl-2,6-dimethylbenzoyl)-(4-pentylphenyl)phosphinic acid (PubChem CID 155257563) has the molecular formula C27H39O3P and a molecular weight of 442.58 g/mol. Its IUPAC name is (4-heptyl-2,6-dimethylbenzoyl)-(4-pentylphenyl)phosphinic acid.
| Compound Name | (4-heptyl-2,6-dimethylbenzoyl)-(4-pentylphenyl)phosphinic acid |
|---|---|
| PubChem CID | 155257563 |
| Molecular Formula | C27H39O3P |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | (4-heptyl-2,6-dimethylbenzoyl)-(4-pentylphenyl)phosphinic acid |
| SMILES | CCCCCCCc1cc(C)c(C(=O)P(=O)(O)c2ccc(CCCCC)cc2)c(C)c1 |
| InChI | InChI=1S/C27H39O3P/c1-5-7-9-10-12-14-24-19-21(3)26(22(4)20-24)27(28)31(29,30)25-17-15-23(16-18-25)13-11-8-6-2/h15-20H,5-14H2,1-4H3,(H,29,30) |
| InChIKey | PGBKLFJJLGLSIH-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|