C30H48NiO3P- — CID 157108010
nickel;nonylbenzene;(4-nonylphenyl)phosphonic acid (PubChem CID 157108010) has the molecular formula C30H48NiO3P- and a molecular weight of 546.38 g/mol. Its IUPAC name is nickel;nonylbenzene;(4-nonylphenyl)phosphonic acid.
| Compound Name | nickel;nonylbenzene;(4-nonylphenyl)phosphonic acid |
|---|---|
| PubChem CID | 157108010 |
| Molecular Formula | C30H48NiO3P- |
| Molecular Weight | 546.38 g/mol |
| Exact Mass | 545.27 |
| IUPAC Name | nickel;nonylbenzene;(4-nonylphenyl)phosphonic acid |
| SMILES | CCCCCCCCCc1cc[c-]cc1.CCCCCCCCCc1ccc(P(=O)(O)O)cc1.[Ni] |
| InChI | InChI=1S/C15H25O3P.C15H23.Ni/c1-2-3-4-5-6-7-8-9-14-10-12-15(13-11-14)19(16,17)18;1-2-3-4-5-6-7-9-12-15-13-10-8-11-14-15;/h10-13H,2-9H2,1H3,(H2,16,17,18);10-11,13-14H,2-7,9,12H2,1H3;/q;-1; |
| InChIKey | MBSKFXRARWJCMB-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.38 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|