About zinc hexylbenzene
zinc hexylbenzene (PubChem CID 156642936) has the molecular formula C24H34Zn
and a molecular weight of 387.93 g/mol. Its IUPAC name is zinc hexylbenzene.
Molecular Properties
| Compound Name | zinc hexylbenzene |
| PubChem CID | 156642936 |
| Molecular Formula | C24H34Zn |
| Molecular Weight | 387.93 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | zinc hexylbenzene |
| SMILES | CCCCCCc1cc[c-]cc1.CCCCCCc1cc[c-]cc1.[Zn+2] |
| InChI | InChI=1S/2C12H17.Zn/c2*1-2-3-4-6-9-12-10-7-5-8-11-12;/h2*7-8,10-11H,2-4,6,9H2,1H3;/q2*-1;+2 |
| InChIKey | QOWCFAWIDZOVPM-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.93 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc hexylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc hexylbenzene?
The IUPAC name of zinc hexylbenzene (CID 156642936) is zinc hexylbenzene.
What is the SMILES notation for zinc hexylbenzene?
The canonical SMILES for zinc hexylbenzene is CCCCCCc1cc[c-]cc1.CCCCCCc1cc[c-]cc1.[Zn+2].
What is the InChIKey of zinc hexylbenzene?
The InChIKey is QOWCFAWIDZOVPM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H17.Zn/c2*1-2-3-4-6-9-12-10-7-5-8-11-12;/h2*7-8,10-11H,2-4,6,9H2,1H3;/q2*-1;+2.
What are the key properties of zinc hexylbenzene?
zinc hexylbenzene has a molecular weight of 387.93 g/mol, XLogP of 7.22, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for zinc hexylbenzene is sourced from PubChem (CID 156642936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).