About bromozinc(1+);1-heptyl-4-phenylbenzene
bromozinc(1+);1-heptyl-4-phenylbenzene (PubChem CID 146001623) has the molecular formula C19H23BrZn
and a molecular weight of 396.69 g/mol. Its IUPAC name is bromozinc(1+);1-heptyl-4-phenylbenzene.
Molecular Properties
| Compound Name | bromozinc(1+);1-heptyl-4-phenylbenzene |
| PubChem CID | 146001623 |
| Molecular Formula | C19H23BrZn |
| Molecular Weight | 396.69 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | bromozinc(1+);1-heptyl-4-phenylbenzene |
| SMILES | CCCCCCCc1ccc(-c2cc[c-]cc2)cc1.[Zn+]Br |
| InChI | InChI=1S/C19H23.BrH.Zn/c1-2-3-4-5-7-10-17-13-15-19(16-14-17)18-11-8-6-9-12-18;;/h8-9,11-16H,2-5,7,10H2,1H3;1H;/q-1;;+2/p-1 |
| InChIKey | TXUTXDDXYNBSEX-UHFFFAOYSA-M |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.69 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bromozinc(1+);1-heptyl-4-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromozinc(1+);1-heptyl-4-phenylbenzene?
The IUPAC name of bromozinc(1+);1-heptyl-4-phenylbenzene (CID 146001623) is bromozinc(1+);1-heptyl-4-phenylbenzene.
What is the SMILES notation for bromozinc(1+);1-heptyl-4-phenylbenzene?
The canonical SMILES for bromozinc(1+);1-heptyl-4-phenylbenzene is CCCCCCCc1ccc(-c2cc[c-]cc2)cc1.[Zn+]Br.
What is the InChIKey of bromozinc(1+);1-heptyl-4-phenylbenzene?
The InChIKey is TXUTXDDXYNBSEX-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H23.BrH.Zn/c1-2-3-4-5-7-10-17-13-15-19(16-14-17)18-11-8-6-9-12-18;;/h8-9,11-16H,2-5,7,10H2,1H3;1H;/q-1;;+2/p-1.
What are the key properties of bromozinc(1+);1-heptyl-4-phenylbenzene?
bromozinc(1+);1-heptyl-4-phenylbenzene has a molecular weight of 396.69 g/mol, XLogP of 6.51, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bromozinc(1+);1-heptyl-4-phenylbenzene is sourced from PubChem (CID 146001623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).