About zinc;decylbenzene;chloride
zinc;decylbenzene;chloride (PubChem CID 162030336) has the molecular formula C16H25ClZn
and a molecular weight of 318.22 g/mol. Its IUPAC name is zinc;decylbenzene;chloride.
Molecular Properties
| Compound Name | zinc;decylbenzene;chloride |
| PubChem CID | 162030336 |
| Molecular Formula | C16H25ClZn |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | zinc;decylbenzene;chloride |
| SMILES | CCCCCCCCCCc1cc[c-]cc1.[Cl-].[Zn+2] |
| InChI | InChI=1S/C16H25.ClH.Zn/c1-2-3-4-5-6-7-8-10-13-16-14-11-9-12-15-16;;/h11-12,14-15H,2-8,10,13H2,1H3;1H;/q-1;;+2/p-1 |
| InChIKey | FXTZLGAOZFXWLJ-UHFFFAOYSA-M |
| XLogP | 2.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;decylbenzene;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;decylbenzene;chloride?
The IUPAC name of zinc;decylbenzene;chloride (CID 162030336) is zinc;decylbenzene;chloride.
What is the SMILES notation for zinc;decylbenzene;chloride?
The canonical SMILES for zinc;decylbenzene;chloride is CCCCCCCCCCc1cc[c-]cc1.[Cl-].[Zn+2].
What is the InChIKey of zinc;decylbenzene;chloride?
The InChIKey is FXTZLGAOZFXWLJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H25.ClH.Zn/c1-2-3-4-5-6-7-8-10-13-16-14-11-9-12-15-16;;/h11-12,14-15H,2-8,10,13H2,1H3;1H;/q-1;;+2/p-1.
What are the key properties of zinc;decylbenzene;chloride?
zinc;decylbenzene;chloride has a molecular weight of 318.22 g/mol, XLogP of 2.17, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;decylbenzene;chloride is sourced from PubChem (CID 162030336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).