About nickel;nonylbenzene
nickel;nonylbenzene (PubChem CID 142762749) has the molecular formula C15H23Ni-
and a molecular weight of 262.04 g/mol. Its IUPAC name is nickel;nonylbenzene.
Molecular Properties
| Compound Name | nickel;nonylbenzene |
| PubChem CID | 142762749 |
| Molecular Formula | C15H23Ni- |
| Molecular Weight | 262.04 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | nickel;nonylbenzene |
| SMILES | CCCCCCCCCc1cc[c-]cc1.[Ni] |
| InChI | InChI=1S/C15H23.Ni/c1-2-3-4-5-6-7-9-12-15-13-10-8-11-14-15;/h10-11,13-14H,2-7,9,12H2,1H3;/q-1; |
| InChIKey | LVYLJZKIKUDYTQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.04 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze nickel;nonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel;nonylbenzene?
The IUPAC name of nickel;nonylbenzene (CID 142762749) is nickel;nonylbenzene.
What is the SMILES notation for nickel;nonylbenzene?
The canonical SMILES for nickel;nonylbenzene is CCCCCCCCCc1cc[c-]cc1.[Ni].
What is the InChIKey of nickel;nonylbenzene?
The InChIKey is LVYLJZKIKUDYTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23.Ni/c1-2-3-4-5-6-7-9-12-15-13-10-8-11-14-15;/h10-11,13-14H,2-7,9,12H2,1H3;/q-1;.
What are the key properties of nickel;nonylbenzene?
nickel;nonylbenzene has a molecular weight of 262.04 g/mol, XLogP of 4.78, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for nickel;nonylbenzene is sourced from PubChem (CID 142762749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).