C19H20N2O4S — CID 155260882
4-[3-(3-aminoquinolin-2-yl)-3-hydroxybutyl]benzenesulfonic acid (PubChem CID 155260882) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is 4-[3-(3-aminoquinolin-2-yl)-3-hydroxybutyl]benzenesulfonic acid.
| Compound Name | 4-[3-(3-aminoquinolin-2-yl)-3-hydroxybutyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 155260882 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 4-[3-(3-aminoquinolin-2-yl)-3-hydroxybutyl]benzenesulfonic acid |
| SMILES | CC(O)(CCc1ccc(S(=O)(=O)O)cc1)c1nc2ccccc2cc1N |
| InChI | InChI=1S/C19H20N2O4S/c1-19(22,11-10-13-6-8-15(9-7-13)26(23,24)25)18-16(20)12-14-4-2-3-5-17(14)21-18/h2-9,12,22H,10-11,20H2,1H3,(H,23,24,25) |
| InChIKey | JGMMMKZRUVVUSG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|