C18H22ClNO4 — CID 155263290
(2R,4R)-6-chloro-4-hydroxy-N-[[(1S,2S,4S,5R)-5-methyl-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]-3,4-dihydro-2H-chromene-2-carboxamide (PubChem CID 155263290) has the molecular formula C18H22ClNO4 and a molecular weight of 351.83 g/mol. Its IUPAC name is (2R,4R)-6-chloro-4-hydroxy-N-[[(1S,2S,4S,5R)-5-methyl-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]-3,4-dihydro-2H-chromene-2-carboxamide.
| Compound Name | (2R,4R)-6-chloro-4-hydroxy-N-[[(1S,2S,4S,5R)-5-methyl-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]-3,4-dihydro-2H-chromene-2-carboxamide |
|---|---|
| PubChem CID | 155263290 |
| Molecular Formula | C18H22ClNO4 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | (2R,4R)-6-chloro-4-hydroxy-N-[[(1S,2S,4S,5R)-5-methyl-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]-3,4-dihydro-2H-chromene-2-carboxamide |
| SMILES | C[C@@H]1C[C@@H]2O[C@H]1C[C@H]2CNC(=O)[C@H]1C[C@@H](O)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C18H22ClNO4/c1-9-4-16-10(5-15(9)24-16)8-20-18(22)17-7-13(21)12-6-11(19)2-3-14(12)23-17/h2-3,6,9-10,13,15-17,21H,4-5,7-8H2,1H3,(H,20,22)/t9-,10+,13-,15+,16+,17-/m1/s1 |
| InChIKey | LRNBJBJYNFNCEE-RRPFNTRMSA-N |
| XLogP | 2.45 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |