About 1-[[1-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]cyclopropyl]methyl]piperidine-4-carboxylic acid
1-[[1-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]cyclopropyl]methyl]piperidine-4-carboxylic acid (PubChem CID 155266125) has the molecular formula C20H28N2O2
and a molecular weight of 328.46 g/mol. Its IUPAC name is 1-[[1-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]cyclopropyl]methyl]piperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[[1-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]cyclopropyl]methyl]piperidine-4-carboxylic acid |
| PubChem CID | 155266125 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 1-[[1-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]cyclopropyl]methyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(CC2(CN[C@H]3C[C@@H]3c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C20H28N2O2/c23-19(24)16-6-10-22(11-7-16)14-20(8-9-20)13-21-18-12-17(18)15-4-2-1-3-5-15/h1-5,16-18,21H,6-14H2,(H,23,24)/t17-,18+/m1/s1 |
| InChIKey | FVOWSZVVJYZGNB-MSOLQXFVSA-N |
| XLogP | 2.71 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[1-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]cyclopropyl]methyl]piperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[1-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]cyclopropyl]methyl]piperidine-4-carboxylic acid?
The IUPAC name of 1-[[1-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]cyclopropyl]methyl]piperidine-4-carboxylic acid (CID 155266125) is 1-[[1-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]cyclopropyl]methyl]piperidine-4-carboxylic acid.
What is the SMILES notation for 1-[[1-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]cyclopropyl]methyl]piperidine-4-carboxylic acid?
The canonical SMILES for 1-[[1-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]cyclopropyl]methyl]piperidine-4-carboxylic acid is O=C(O)C1CCN(CC2(CN[C@H]3C[C@@H]3c3ccccc3)CC2)CC1.
What is the InChIKey of 1-[[1-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]cyclopropyl]methyl]piperidine-4-carboxylic acid?
The InChIKey is FVOWSZVVJYZGNB-MSOLQXFVSA-N. The full InChI is InChI=1S/C20H28N2O2/c23-19(24)16-6-10-22(11-7-16)14-20(8-9-20)13-21-18-12-17(18)15-4-2-1-3-5-15/h1-5,16-18,21H,6-14H2,(H,23,24)/t17-,18+/m1/s1.
What are the key properties of 1-[[1-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]cyclopropyl]methyl]piperidine-4-carboxylic acid?
1-[[1-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]cyclopropyl]methyl]piperidine-4-carboxylic acid has a molecular weight of 328.46 g/mol, XLogP of 2.71, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[1-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]cyclopropyl]methyl]piperidine-4-carboxylic acid is sourced from PubChem (CID 155266125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).