C22H31N3O2 — CID 155266723
2-[5-[[1-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]cyclopropyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]acetic acid (PubChem CID 155266723) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is 2-[5-[[1-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]cyclopropyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]acetic acid.
| Compound Name | 2-[5-[[1-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]cyclopropyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]acetic acid |
|---|---|
| PubChem CID | 155266723 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 2-[5-[[1-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]cyclopropyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]acetic acid |
| SMILES | O=C(O)CN1CC2CN(CC3(CN[C@H]4C[C@@H]4c4ccccc4)CC3)CC2C1 |
| InChI | InChI=1S/C22H31N3O2/c26-21(27)13-24-9-17-11-25(12-18(17)10-24)15-22(6-7-22)14-23-20-8-19(20)16-4-2-1-3-5-16/h1-5,17-20,23H,6-15H2,(H,26,27)/t17?,18?,19-,20+/m1/s1 |
| InChIKey | CDPDIWCIHWHJDT-TUNPWDSISA-N |
| XLogP | 1.86 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |