C18H22N2S2 — CID 155267059
1-[2-[2,4-bis(deuteriomethylsulfanyl)phenyl]phenyl]piperazine (PubChem CID 155267059) has the molecular formula C18H22N2S2 and a molecular weight of 332.53 g/mol. Its IUPAC name is 1-[2-[2,4-bis(deuteriomethylsulfanyl)phenyl]phenyl]piperazine.
| Compound Name | 1-[2-[2,4-bis(deuteriomethylsulfanyl)phenyl]phenyl]piperazine |
|---|---|
| PubChem CID | 155267059 |
| Molecular Formula | C18H22N2S2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1-[2-[2,4-bis(deuteriomethylsulfanyl)phenyl]phenyl]piperazine |
| SMILES | [2H]CSc1ccc(-c2ccccc2N2CCNCC2)c(SC[2H])c1 |
| InChI | InChI=1S/C18H22N2S2/c1-21-14-7-8-16(18(13-14)22-2)15-5-3-4-6-17(15)20-11-9-19-10-12-20/h3-8,13,19H,9-12H2,1-2H3/i1D,2D |
| InChIKey | YEZYVDCVVBWKLH-QDNHWIQGSA-N |
| XLogP | 4.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |