C15H21F3N4O2S — CID 155270535
1-[3-[[2-methylsulfinyl-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]azepan-2-one (PubChem CID 155270535) has the molecular formula C15H21F3N4O2S and a molecular weight of 378.42 g/mol. Its IUPAC name is 1-[3-[[2-methylsulfinyl-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]azepan-2-one.
| Compound Name | 1-[3-[[2-methylsulfinyl-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]azepan-2-one |
|---|---|
| PubChem CID | 155270535 |
| Molecular Formula | C15H21F3N4O2S |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 1-[3-[[2-methylsulfinyl-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]azepan-2-one |
| SMILES | CS(=O)c1ncc(C(F)(F)F)c(NCCCN2CCCCCC2=O)n1 |
| InChI | InChI=1S/C15H21F3N4O2S/c1-25(24)14-20-10-11(15(16,17)18)13(21-14)19-7-5-9-22-8-4-2-3-6-12(22)23/h10H,2-9H2,1H3,(H,19,20,21) |
| InChIKey | QNXVRXAEQYZENQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|