C14H19F3N4OS — CID 155280271
1-[3-[[2-methylsulfanyl-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]piperidin-2-one (PubChem CID 155280271) has the molecular formula C14H19F3N4OS and a molecular weight of 348.39 g/mol. Its IUPAC name is 1-[3-[[2-methylsulfanyl-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]piperidin-2-one.
| Compound Name | 1-[3-[[2-methylsulfanyl-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]piperidin-2-one |
|---|---|
| PubChem CID | 155280271 |
| Molecular Formula | C14H19F3N4OS |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 1-[3-[[2-methylsulfanyl-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]piperidin-2-one |
| SMILES | CSc1ncc(C(F)(F)F)c(NCCCN2CCCCC2=O)n1 |
| InChI | InChI=1S/C14H19F3N4OS/c1-23-13-19-9-10(14(15,16)17)12(20-13)18-6-4-8-21-7-3-2-5-11(21)22/h9H,2-8H2,1H3,(H,18,19,20) |
| InChIKey | ZUTWYEXBJFJQIH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|