C31H43N7O7P+ — CID 155271320
[1-(2-amino-2-oxoethyl)-4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-ium-1-yl]methyl N-methyl-N-(2-phosphonooxyethyl)carbamate (PubChem CID 155271320) has the molecular formula C31H43N7O7P+ and a molecular weight of 656.70 g/mol. Its IUPAC name is [1-(2-amino-2-oxoethyl)-4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-ium-1-yl]methyl N-methyl-N-(2-phosphonooxyethyl)carbamate.
| Compound Name | [1-(2-amino-2-oxoethyl)-4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-ium-1-yl]methyl N-methyl-N-(2-phosphonooxyethyl)carbamate |
|---|---|
| PubChem CID | 155271320 |
| Molecular Formula | C31H43N7O7P+ |
| Molecular Weight | 656.70 g/mol |
| Exact Mass | 656.30 |
| IUPAC Name | [1-(2-amino-2-oxoethyl)-4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-ium-1-yl]methyl N-methyl-N-(2-phosphonooxyethyl)carbamate |
| SMILES | Cc1c(-c2[nH]c3ccc(C4CC[N+](COC(=O)N(C)CCOP(=O)(O)O)(CC(N)=O)CC4)cc3c2C(C)C)cn2ncnc2c1C |
| InChI | InChI=1S/C31H42N7O7P/c1-19(2)28-24-14-23(6-7-26(24)35-29(28)25-15-37-30(33-17-34-37)21(4)20(25)3)22-8-11-38(12-9-22,16-27(32)39)18-44-31(40)36(5)10-13-45-46(41,42)43/h6-7,14-15,17,19,22,35H,8-13,16,18H2,1-5H3,(H3-,32,39,41,42,43)/p+1 |
| InChIKey | XAYRAYQYXQSREX-UHFFFAOYSA-O |
| XLogP | 3.93 |
| TPSA | 185.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.70 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|