C31H43N6O5P — CID 164811187
[6-[5-[1-(2-amino-2-oxoethyl)piperidin-4-yl]-3-propan-2-yl-1H-indol-2-yl]-7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-1-ium-1-yl]methyl tert-butyl phosphate (PubChem CID 164811187) has the molecular formula C31H43N6O5P and a molecular weight of 610.70 g/mol. Its IUPAC name is [6-[5-[1-(2-amino-2-oxoethyl)piperidin-4-yl]-3-propan-2-yl-1H-indol-2-yl]-7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-1-ium-1-yl]methyl tert-butyl phosphate.
| Compound Name | [6-[5-[1-(2-amino-2-oxoethyl)piperidin-4-yl]-3-propan-2-yl-1H-indol-2-yl]-7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-1-ium-1-yl]methyl tert-butyl phosphate |
|---|---|
| PubChem CID | 164811187 |
| Molecular Formula | C31H43N6O5P |
| Molecular Weight | 610.70 g/mol |
| Exact Mass | 610.30 |
| IUPAC Name | [6-[5-[1-(2-amino-2-oxoethyl)piperidin-4-yl]-3-propan-2-yl-1H-indol-2-yl]-7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-1-ium-1-yl]methyl tert-butyl phosphate |
| SMILES | Cc1c(-c2[nH]c3ccc(C4CCN(CC(N)=O)CC4)cc3c2C(C)C)cn2nc[n+](COP(=O)([O-])OC(C)(C)C)c2c1C |
| InChI | InChI=1S/C31H43N6O5P/c1-19(2)28-24-14-23(22-10-12-35(13-11-22)16-27(32)38)8-9-26(24)34-29(28)25-15-37-30(21(4)20(25)3)36(17-33-37)18-41-43(39,40)42-31(5,6)7/h8-9,14-15,17,19,22,34H,10-13,16,18H2,1-7H3,(H2-,32,38,39,40) |
| InChIKey | LKCAQHNQPURLMZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 141.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.70 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|