C22H19FN2O6S2 — CID 155271399
4-cyclopropyl-3-[(4-fluoro-5-methylsulfonyl-2-pyridin-2-ylphenyl)sulfamoyl]benzoic acid (PubChem CID 155271399) has the molecular formula C22H19FN2O6S2 and a molecular weight of 490.53 g/mol. Its IUPAC name is 4-cyclopropyl-3-[(4-fluoro-5-methylsulfonyl-2-pyridin-2-ylphenyl)sulfamoyl]benzoic acid.
| Compound Name | 4-cyclopropyl-3-[(4-fluoro-5-methylsulfonyl-2-pyridin-2-ylphenyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 155271399 |
| Molecular Formula | C22H19FN2O6S2 |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | 4-cyclopropyl-3-[(4-fluoro-5-methylsulfonyl-2-pyridin-2-ylphenyl)sulfamoyl]benzoic acid |
| SMILES | CS(=O)(=O)c1cc(NS(=O)(=O)c2cc(C(=O)O)ccc2C2CC2)c(-c2ccccn2)cc1F |
| InChI | InChI=1S/C22H19FN2O6S2/c1-32(28,29)21-12-19(16(11-17(21)23)18-4-2-3-9-24-18)25-33(30,31)20-10-14(22(26)27)7-8-15(20)13-5-6-13/h2-4,7-13,25H,5-6H2,1H3,(H,26,27) |
| InChIKey | JXSMXSFZYANXEE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 130.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |