C13H16ClN3O2 — CID 155273088
5-(2-methoxypyrimidin-4-yl)-5-azaspiro[2.5]octane-8-carbonyl chloride (PubChem CID 155273088) has the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. Its IUPAC name is 5-(2-methoxypyrimidin-4-yl)-5-azaspiro[2.5]octane-8-carbonyl chloride.
| Compound Name | 5-(2-methoxypyrimidin-4-yl)-5-azaspiro[2.5]octane-8-carbonyl chloride |
|---|---|
| PubChem CID | 155273088 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 5-(2-methoxypyrimidin-4-yl)-5-azaspiro[2.5]octane-8-carbonyl chloride |
| SMILES | COc1nccc(N2CCC(C(=O)Cl)C3(CC3)C2)n1 |
| InChI | InChI=1S/C13H16ClN3O2/c1-19-12-15-6-2-10(16-12)17-7-3-9(11(14)18)13(8-17)4-5-13/h2,6,9H,3-5,7-8H2,1H3 |
| InChIKey | CGHIZXKCXYNBAK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|