C18H21FN4O2S — CID 118191153
S-(4-fluorophenyl) N-[1-(2-methoxypyrimidin-4-yl)piperidin-4-yl]-N-methylcarbamothioate (PubChem CID 118191153) has the molecular formula C18H21FN4O2S and a molecular weight of 376.46 g/mol. Its IUPAC name is S-(4-fluorophenyl) N-[1-(2-methoxypyrimidin-4-yl)piperidin-4-yl]-N-methylcarbamothioate.
| Compound Name | S-(4-fluorophenyl) N-[1-(2-methoxypyrimidin-4-yl)piperidin-4-yl]-N-methylcarbamothioate |
|---|---|
| PubChem CID | 118191153 |
| Molecular Formula | C18H21FN4O2S |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | S-(4-fluorophenyl) N-[1-(2-methoxypyrimidin-4-yl)piperidin-4-yl]-N-methylcarbamothioate |
| SMILES | COc1nccc(N2CCC(N(C)C(=O)Sc3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C18H21FN4O2S/c1-22(18(24)26-15-5-3-13(19)4-6-15)14-8-11-23(12-9-14)16-7-10-20-17(21-16)25-2/h3-7,10,14H,8-9,11-12H2,1-2H3 |
| InChIKey | LBAAROPQVXTNKI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|