C11H11N3O2 — CID 155273411
N-ethyl-5-pyridin-2-yl-1,2-oxazole-3-carboxamide (PubChem CID 155273411) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is N-ethyl-5-pyridin-2-yl-1,2-oxazole-3-carboxamide.
| Compound Name | N-ethyl-5-pyridin-2-yl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 155273411 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | N-ethyl-5-pyridin-2-yl-1,2-oxazole-3-carboxamide |
| SMILES | CCNC(=O)c1cc(-c2ccccn2)on1 |
| InChI | InChI=1S/C11H11N3O2/c1-2-12-11(15)9-7-10(16-14-9)8-5-3-4-6-13-8/h3-7H,2H2,1H3,(H,12,15) |
| InChIKey | JEEHZMQCSZKBMY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |