About ethane;3-iodo-5-pyridin-2-yl-1,2-oxazole
ethane;3-iodo-5-pyridin-2-yl-1,2-oxazole (PubChem CID 144804374) has the molecular formula C10H11IN2O
and a molecular weight of 302.12 g/mol. Its IUPAC name is ethane;3-iodo-5-pyridin-2-yl-1,2-oxazole.
Molecular Properties
| Compound Name | ethane;3-iodo-5-pyridin-2-yl-1,2-oxazole |
| PubChem CID | 144804374 |
| Molecular Formula | C10H11IN2O |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | ethane;3-iodo-5-pyridin-2-yl-1,2-oxazole |
| SMILES | CC.Ic1cc(-c2ccccn2)on1 |
| InChI | InChI=1S/C8H5IN2O.C2H6/c9-8-5-7(12-11-8)6-3-1-2-4-10-6;1-2/h1-5H;1-2H3 |
| InChIKey | CCCPVVGVQOVVKP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-iodo-5-pyridin-2-yl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-iodo-5-pyridin-2-yl-1,2-oxazole?
The IUPAC name of ethane;3-iodo-5-pyridin-2-yl-1,2-oxazole (CID 144804374) is ethane;3-iodo-5-pyridin-2-yl-1,2-oxazole.
What is the SMILES notation for ethane;3-iodo-5-pyridin-2-yl-1,2-oxazole?
The canonical SMILES for ethane;3-iodo-5-pyridin-2-yl-1,2-oxazole is CC.Ic1cc(-c2ccccn2)on1.
What is the InChIKey of ethane;3-iodo-5-pyridin-2-yl-1,2-oxazole?
The InChIKey is CCCPVVGVQOVVKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5IN2O.C2H6/c9-8-5-7(12-11-8)6-3-1-2-4-10-6;1-2/h1-5H;1-2H3.
What are the key properties of ethane;3-iodo-5-pyridin-2-yl-1,2-oxazole?
ethane;3-iodo-5-pyridin-2-yl-1,2-oxazole has a molecular weight of 302.12 g/mol, XLogP of 3.37, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-iodo-5-pyridin-2-yl-1,2-oxazole is sourced from PubChem (CID 144804374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).