C9H8N2O3 — CID 155273393
(5-pyridin-2-yl-1,2-oxazol-3-yl)methanediol (PubChem CID 155273393) has the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. Its IUPAC name is (5-pyridin-2-yl-1,2-oxazol-3-yl)methanediol.
| Compound Name | (5-pyridin-2-yl-1,2-oxazol-3-yl)methanediol |
|---|---|
| PubChem CID | 155273393 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | (5-pyridin-2-yl-1,2-oxazol-3-yl)methanediol |
| SMILES | OC(O)c1cc(-c2ccccn2)on1 |
| InChI | InChI=1S/C9H8N2O3/c12-9(13)7-5-8(14-11-7)6-3-1-2-4-10-6/h1-5,9,12-13H |
| InChIKey | MFEMCXHSLLMYKG-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|