C13H21N3O5 — CID 155273452
3-amino-4-[2-[(2E)-cyclooct-2-en-1-yl]oxycarbonylhydrazinyl]-4-oxobutanoic acid (PubChem CID 155273452) has the molecular formula C13H21N3O5 and a molecular weight of 299.33 g/mol. Its IUPAC name is 3-amino-4-[2-[(2E)-cyclooct-2-en-1-yl]oxycarbonylhydrazinyl]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[2-[(2E)-cyclooct-2-en-1-yl]oxycarbonylhydrazinyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 155273452 |
| Molecular Formula | C13H21N3O5 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 3-amino-4-[2-[(2E)-cyclooct-2-en-1-yl]oxycarbonylhydrazinyl]-4-oxobutanoic acid |
| SMILES | NC(CC(=O)O)C(=O)NNC(=O)OC1/C=C\CCCCC1 |
| InChI | InChI=1S/C13H21N3O5/c14-10(8-11(17)18)12(19)15-16-13(20)21-9-6-4-2-1-3-5-7-9/h4,6,9-10H,1-3,5,7-8,14H2,(H,15,19)(H,16,20)(H,17,18)/b6-4- |
| InChIKey | HLSWXUCYECEOBQ-XQRVVYSFSA-N |
| XLogP | 0.43 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|